C19H20FN3O2S2 — CID 1402476
1-[(4S)-3-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea (PubChem CID 1402476) has the molecular formula C19H20FN3O2S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[(4S)-3-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea.
| Compound Name | 1-[(4S)-3-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea |
|---|---|
| PubChem CID | 1402476 |
| Molecular Formula | C19H20FN3O2S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-[(4S)-3-[(4-fluorophenyl)methyl]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-phenylurea |
| SMILES | CC1(C)SC(=S)N(Cc2ccc(F)cc2)[C@H]1N(O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H20FN3O2S2/c1-19(2)16(23(25)17(24)21-15-6-4-3-5-7-15)22(18(26)27-19)12-13-8-10-14(20)11-9-13/h3-11,16,25H,12H2,1-2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | ZUHDUGKHVXNUBS-INIZCTEOSA-N |
| XLogP | 4.69 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|