C21H20F3N3O4S2 — CID 40879548
1-[(4R)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 40879548) has the molecular formula C21H20F3N3O4S2 and a molecular weight of 499.54 g/mol. Its IUPAC name is 1-[(4R)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4R)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 40879548 |
| Molecular Formula | C21H20F3N3O4S2 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 1-[(4R)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC1(C)SC(=S)N(Cc2ccc3c(c2)OCO3)[C@@H]1N(O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N3O4S2/c1-20(2)17(27(29)18(28)25-14-5-3-4-13(9-14)21(22,23)24)26(19(32)33-20)10-12-6-7-15-16(8-12)31-11-30-15/h3-9,17,29H,10-11H2,1-2H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | GHJUPZCBWKUUJI-QGZVFWFLSA-N |
| XLogP | 5.30 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|