C29H28F6N4O5 — CID 98308729
1-[(4S)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 98308729) has the molecular formula C29H28F6N4O5 and a molecular weight of 626.55 g/mol. Its IUPAC name is 1-[(4S)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4S)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 98308729 |
| Molecular Formula | C29H28F6N4O5 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 1-[(4S)-1-[(3,5-dimethoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-1-hydroxy-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cc(CN2C(=O)N(c3cccc(C(F)(F)F)c3)[C@@H](N(O)C(=O)Nc3cccc(C(F)(F)F)c3)C2(C)C)cc(OC)c1 |
| InChI | InChI=1S/C29H28F6N4O5/c1-27(2)24(39(42)25(40)36-20-9-5-7-18(13-20)28(30,31)32)38(21-10-6-8-19(14-21)29(33,34)35)26(41)37(27)16-17-11-22(43-3)15-23(12-17)44-4/h5-15,24,42H,16H2,1-4H3,(H,36,40)/t24-/m0/s1 |
| InChIKey | TTWMZVOKLUEMCY-DEOSSOPVSA-N |
| XLogP | 7.21 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|