C20H16F3NO4 — CID 1334862
(2R)-3-acetyl-4-hydroxy-2-(4-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 1334862) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is (2R)-3-acetyl-4-hydroxy-2-(4-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | (2R)-3-acetyl-4-hydroxy-2-(4-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 1334862 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (2R)-3-acetyl-4-hydroxy-2-(4-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | COc1ccc([C@@H]2C(C(C)=O)=C(O)C(=O)N2c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H16F3NO4/c1-11(25)16-17(12-6-8-15(28-2)9-7-12)24(19(27)18(16)26)14-5-3-4-13(10-14)20(21,22)23/h3-10,17,26H,1-2H3/t17-/m1/s1 |
| InChIKey | UDNUMYYUBLCWJZ-QGZVFWFLSA-N |
| XLogP | 4.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |