C19H13F4NO3 — CID 2868328
3-acetyl-2-(2-fluorophenyl)-4-hydroxy-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 2868328) has the molecular formula C19H13F4NO3 and a molecular weight of 379.31 g/mol. Its IUPAC name is 3-acetyl-2-(2-fluorophenyl)-4-hydroxy-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-2-(2-fluorophenyl)-4-hydroxy-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 2868328 |
| Molecular Formula | C19H13F4NO3 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-acetyl-2-(2-fluorophenyl)-4-hydroxy-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(c2cccc(C(F)(F)F)c2)C1c1ccccc1F |
| InChI | InChI=1S/C19H13F4NO3/c1-10(25)15-16(13-7-2-3-8-14(13)20)24(18(27)17(15)26)12-6-4-5-11(9-12)19(21,22)23/h2-9,16,26H,1H3 |
| InChIKey | LVWLYXDVWGQALY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |