C26H17F4NO3 — CID 41033204
(2S)-2-(2-fluorophenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 41033204) has the molecular formula C26H17F4NO3 and a molecular weight of 467.42 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | (2S)-2-(2-fluorophenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 41033204 |
| Molecular Formula | C26H17F4NO3 |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2S)-2-(2-fluorophenyl)-4-hydroxy-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(c2cccc(C(F)(F)F)c2)[C@@H]1c1ccccc1F |
| InChI | InChI=1S/C26H17F4NO3/c27-20-12-5-4-11-19(20)23-22(21(32)14-13-16-7-2-1-3-8-16)24(33)25(34)31(23)18-10-6-9-17(15-18)26(28,29)30/h1-15,23,33H/b14-13+/t23-/m1/s1 |
| InChIKey | XTRWDAGZJMWUSW-YAOQVBECSA-N |
| XLogP | 6.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|