C28H23NO7 — CID 3708962
3-[2-(2,5-dimethoxyphenyl)-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]benzoic acid (PubChem CID 3708962) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is 3-[2-(2,5-dimethoxyphenyl)-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]benzoic acid.
| Compound Name | 3-[2-(2,5-dimethoxyphenyl)-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3708962 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-[2-(2,5-dimethoxyphenyl)-4-hydroxy-5-oxo-3-(3-phenylprop-2-enoyl)-2H-pyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(OC)c(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C28H23NO7/c1-35-20-12-14-23(36-2)21(16-20)25-24(22(30)13-11-17-7-4-3-5-8-17)26(31)27(32)29(25)19-10-6-9-18(15-19)28(33)34/h3-16,25,31H,1-2H3,(H,33,34) |
| InChIKey | YMEFUYHMYUWAIG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|