C26H17F3N2O5 — CID 40910045
(2S)-4-hydroxy-2-(3-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one (PubChem CID 40910045) has the molecular formula C26H17F3N2O5 and a molecular weight of 494.43 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(3-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one.
| Compound Name | (2S)-4-hydroxy-2-(3-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 40910045 |
| Molecular Formula | C26H17F3N2O5 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (2S)-4-hydroxy-2-(3-nitrophenyl)-3-[(E)-3-phenylprop-2-enoyl]-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-5-one |
| SMILES | O=C(/C=C/c1ccccc1)C1=C(O)C(=O)N(c2cccc(C(F)(F)F)c2)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H17F3N2O5/c27-26(28,29)18-9-5-10-19(15-18)30-23(17-8-4-11-20(14-17)31(35)36)22(24(33)25(30)34)21(32)13-12-16-6-2-1-3-7-16/h1-15,23,33H/b13-12+/t23-/m0/s1 |
| InChIKey | IQZIAAKJQDOIHW-OTOIZHKDSA-N |
| XLogP | 5.80 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|