C28H26F6N4O4 — CID 98377381
1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 98377381) has the molecular formula C28H26F6N4O4 and a molecular weight of 596.53 g/mol. Its IUPAC name is 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 98377381 |
| Molecular Formula | C28H26F6N4O4 |
| Molecular Weight | 596.53 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 1-hydroxy-1-[(4S)-1-[(4-methoxyphenyl)methyl]-5,5-dimethyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-4-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(CN2C(=O)N(c3cccc(C(F)(F)F)c3)[C@@H](N(O)C(=O)Nc3cccc(C(F)(F)F)c3)C2(C)C)cc1 |
| InChI | InChI=1S/C28H26F6N4O4/c1-26(2)23(38(41)24(39)35-20-8-4-6-18(14-20)27(29,30)31)37(21-9-5-7-19(15-21)28(32,33)34)25(40)36(26)16-17-10-12-22(42-3)13-11-17/h4-15,23,41H,16H2,1-3H3,(H,35,39)/t23-/m0/s1 |
| InChIKey | NLORLFLVEPGGLE-QHCPKHFHSA-N |
| XLogP | 7.20 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|