C26H24Cl2N4O5 — CID 3705309
1-[1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea (PubChem CID 3705309) has the molecular formula C26H24Cl2N4O5 and a molecular weight of 543.41 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 3705309 |
| Molecular Formula | C26H24Cl2N4O5 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-ylmethyl)-3-(3-chlorophenyl)-5,5-dimethyl-2-oxoimidazolidin-4-yl]-3-(3-chlorophenyl)-1-hydroxyurea |
| SMILES | CC1(C)C(N(O)C(=O)Nc2cccc(Cl)c2)N(c2cccc(Cl)c2)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H24Cl2N4O5/c1-26(2)23(32(35)24(33)29-19-7-3-5-17(27)12-19)31(20-8-4-6-18(28)13-20)25(34)30(26)14-16-9-10-21-22(11-16)37-15-36-21/h3-13,23,35H,14-15H2,1-2H3,(H,29,33) |
| InChIKey | VRGMVZWVGLTJND-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|