C30H31Cl2FN6O4 — CID 98307424
5-[(4R)-3-(3-chlorophenyl)-4-[(3-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(Z)-(4-fluorophenyl)methylideneamino]pentanamide (PubChem CID 98307424) has the molecular formula C30H31Cl2FN6O4 and a molecular weight of 629.52 g/mol. Its IUPAC name is 5-[(4R)-3-(3-chlorophenyl)-4-[(3-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(Z)-(4-fluorophenyl)methylideneamino]pentanamide.
| Compound Name | 5-[(4R)-3-(3-chlorophenyl)-4-[(3-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(Z)-(4-fluorophenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 98307424 |
| Molecular Formula | C30H31Cl2FN6O4 |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 5-[(4R)-3-(3-chlorophenyl)-4-[(3-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(Z)-(4-fluorophenyl)methylideneamino]pentanamide |
| SMILES | CC1(C)[C@@H](N(O)C(=O)Nc2cccc(Cl)c2)N(c2cccc(Cl)c2)C(=O)N1CCCCC(=O)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C30H31Cl2FN6O4/c1-30(2)27(39(43)28(41)35-24-9-5-7-21(31)17-24)38(25-10-6-8-22(32)18-25)29(42)37(30)16-4-3-11-26(40)36-34-19-20-12-14-23(33)15-13-20/h5-10,12-15,17-19,27,43H,3-4,11,16H2,1-2H3,(H,35,41)(H,36,40)/b34-19-/t27-/m1/s1 |
| InChIKey | SICFJJGSDYFXNZ-OQVGDTCNSA-N |
| XLogP | 6.72 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|