C34H34Cl2N6O5 — CID 3653611
5-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]pentanamide (PubChem CID 3653611) has the molecular formula C34H34Cl2N6O5 and a molecular weight of 677.59 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]pentanamide.
| Compound Name | 5-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 3653611 |
| Molecular Formula | C34H34Cl2N6O5 |
| Molecular Weight | 677.59 g/mol |
| Exact Mass | 676.20 |
| IUPAC Name | 5-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]pentanamide |
| SMILES | CC1(C)C(N(O)C(=O)Nc2ccc(Cl)cc2)N(c2ccc(Cl)cc2)C(=O)N1CCCCC(=O)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C34H34Cl2N6O5/c1-34(2)31(42(47)32(45)38-25-15-11-23(35)12-16-25)41(26-17-13-24(36)14-18-26)33(46)40(34)20-6-5-9-30(44)39-37-21-28-27-8-4-3-7-22(27)10-19-29(28)43/h3-4,7-8,10-19,21,31,43,47H,5-6,9,20H2,1-2H3,(H,38,45)(H,39,44) |
| InChIKey | CCMVFNXJYCFASX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|