C29H31ClN6O4 — CID 3999658
N-[(4-chlorophenyl)methylideneamino]-2-[4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetamide (PubChem CID 3999658) has the molecular formula C29H31ClN6O4 and a molecular weight of 563.06 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methylideneamino]-2-[4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methylideneamino]-2-[4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 3999658 |
| Molecular Formula | C29H31ClN6O4 |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | N-[(4-chlorophenyl)methylideneamino]-2-[4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)N(O)C2N(c3ccc(C)cc3)C(=O)N(CC(=O)NN=Cc3ccc(Cl)cc3)C2(C)C)cc1 |
| InChI | InChI=1S/C29H31ClN6O4/c1-19-5-13-23(14-6-19)32-27(38)36(40)26-29(3,4)34(28(39)35(26)24-15-7-20(2)8-16-24)18-25(37)33-31-17-21-9-11-22(30)12-10-21/h5-17,26,40H,18H2,1-4H3,(H,32,38)(H,33,37) |
| InChIKey | DOPJRSOQGDJNDZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|