C22H24Cl2N4O5 — CID 6990477
ethyl 2-[(4S)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]acetate (PubChem CID 6990477) has the molecular formula C22H24Cl2N4O5 and a molecular weight of 495.36 g/mol. Its IUPAC name is ethyl 2-[(4S)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(4S)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 6990477 |
| Molecular Formula | C22H24Cl2N4O5 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | ethyl 2-[(4S)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)N(c2ccc(Cl)cc2)[C@@H](N(O)C(=O)Nc2ccc(Cl)cc2)C1(C)C |
| InChI | InChI=1S/C22H24Cl2N4O5/c1-4-33-18(29)13-26-21(31)27(17-11-7-15(24)8-12-17)19(22(26,2)3)28(32)20(30)25-16-9-5-14(23)6-10-16/h5-12,19,32H,4,13H2,1-3H3,(H,25,30)/t19-/m0/s1 |
| InChIKey | USWBBVNNTCQJRV-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|