C24H28N5O6- — CID 7147940
2-[[2-[(4R)-4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]acetate (PubChem CID 7147940) has the molecular formula C24H28N5O6- and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-[[2-[(4R)-4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]acetate.
| Compound Name | 2-[[2-[(4R)-4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 7147940 |
| Molecular Formula | C24H28N5O6- |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-[[2-[(4R)-4-[hydroxy-[(4-methylphenyl)carbamoyl]amino]-5,5-dimethyl-3-(4-methylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]acetate |
| SMILES | Cc1ccc(NC(=O)N(O)[C@H]2N(c3ccc(C)cc3)C(=O)N(CC(=O)NCC(=O)[O-])C2(C)C)cc1 |
| InChI | InChI=1S/C24H29N5O6/c1-15-5-9-17(10-6-15)26-22(33)29(35)21-24(3,4)27(14-19(30)25-13-20(31)32)23(34)28(21)18-11-7-16(2)8-12-18/h5-12,21,35H,13-14H2,1-4H3,(H,25,30)(H,26,33)(H,31,32)/p-1/t21-/m1/s1 |
| InChIKey | QMIBUDMONSNNEM-OAQYLSRUSA-M |
| XLogP | 1.44 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|