C25H22Cl4N6O5 — CID 2829484
2-[3-(3,4-dichlorophenyl)-4-[(3,4-dichlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-(furan-2-ylmethylideneamino)acetamide (PubChem CID 2829484) has the molecular formula C25H22Cl4N6O5 and a molecular weight of 628.30 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-4-[(3,4-dichlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-(furan-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-4-[(3,4-dichlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-(furan-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 2829484 |
| Molecular Formula | C25H22Cl4N6O5 |
| Molecular Weight | 628.30 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-4-[(3,4-dichlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]-N-(furan-2-ylmethylideneamino)acetamide |
| SMILES | CC1(C)C(N(O)C(=O)Nc2ccc(Cl)c(Cl)c2)N(c2ccc(Cl)c(Cl)c2)C(=O)N1CC(=O)NN=Cc1ccco1 |
| InChI | InChI=1S/C25H22Cl4N6O5/c1-25(2)22(35(39)23(37)31-14-5-7-17(26)19(28)10-14)34(15-6-8-18(27)20(29)11-15)24(38)33(25)13-21(36)32-30-12-16-4-3-9-40-16/h3-12,22,39H,13H2,1-2H3,(H,31,37)(H,32,36) |
| InChIKey | FFZAFMKZMMHENM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|