C25H30Cl4N4O3 — CID 98380410
3-(3,4-dichlorophenyl)-1-[(4S)-3-(3,4-dichlorophenyl)-1-heptyl-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea (PubChem CID 98380410) has the molecular formula C25H30Cl4N4O3 and a molecular weight of 576.35 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[(4S)-3-(3,4-dichlorophenyl)-1-heptyl-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[(4S)-3-(3,4-dichlorophenyl)-1-heptyl-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 98380410 |
| Molecular Formula | C25H30Cl4N4O3 |
| Molecular Weight | 576.35 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[(4S)-3-(3,4-dichlorophenyl)-1-heptyl-5,5-dimethyl-2-oxoimidazolidin-4-yl]-1-hydroxyurea |
| SMILES | CCCCCCCN1C(=O)N(c2ccc(Cl)c(Cl)c2)[C@@H](N(O)C(=O)Nc2ccc(Cl)c(Cl)c2)C1(C)C |
| InChI | InChI=1S/C25H30Cl4N4O3/c1-4-5-6-7-8-13-31-24(35)32(17-10-12-19(27)21(29)15-17)22(25(31,2)3)33(36)23(34)30-16-9-11-18(26)20(28)14-16/h9-12,14-15,22,36H,4-8,13H2,1-3H3,(H,30,34)/t22-/m0/s1 |
| InChIKey | PUNFPFKTKIWVQD-QFIPXVFZSA-N |
| XLogP | 8.54 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.35 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|