C23H26Cl2N4O5 — CID 40951227
methyl 4-[(4R)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]butanoate (PubChem CID 40951227) has the molecular formula C23H26Cl2N4O5 and a molecular weight of 509.39 g/mol. Its IUPAC name is methyl 4-[(4R)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[(4R)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 40951227 |
| Molecular Formula | C23H26Cl2N4O5 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | methyl 4-[(4R)-3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-oxoimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=O)N(c2ccc(Cl)cc2)[C@H](N(O)C(=O)Nc2ccc(Cl)cc2)C1(C)C |
| InChI | InChI=1S/C23H26Cl2N4O5/c1-23(2)20(29(33)21(31)26-17-10-6-15(24)7-11-17)28(18-12-8-16(25)9-13-18)22(32)27(23)14-4-5-19(30)34-3/h6-13,20,33H,4-5,14H2,1-3H3,(H,26,31)/t20-/m1/s1 |
| InChIKey | OHZQIDDAZNMKHZ-HXUWFJFHSA-N |
| XLogP | 5.22 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|