C22H24Cl2N4O4S — CID 3749978
methyl 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 3749978) has the molecular formula C22H24Cl2N4O4S and a molecular weight of 511.43 g/mol. Its IUPAC name is methyl 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 3749978 |
| Molecular Formula | C22H24Cl2N4O4S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | methyl 2-[3-(4-chlorophenyl)-4-[(4-chlorophenyl)carbamoyl-hydroxyamino]-5,5-dimethyl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)C(C)N1C(=S)N(c2ccc(Cl)cc2)C(N(O)C(=O)Nc2ccc(Cl)cc2)C1(C)C |
| InChI | InChI=1S/C22H24Cl2N4O4S/c1-13(18(29)32-4)27-21(33)26(17-11-7-15(24)8-12-17)19(22(27,2)3)28(31)20(30)25-16-9-5-14(23)6-10-16/h5-13,19,31H,1-4H3,(H,25,30) |
| InChIKey | UYQMQANBWUDVBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|