C16H14Cl2N4O2 — CID 134113027
1-(2-cyanopropyl)-3-(3,4-dichlorophenyl)-1-[(E)-furan-2-ylmethylideneamino]urea (PubChem CID 134113027) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 1-(2-cyanopropyl)-3-(3,4-dichlorophenyl)-1-[(E)-furan-2-ylmethylideneamino]urea.
| Compound Name | 1-(2-cyanopropyl)-3-(3,4-dichlorophenyl)-1-[(E)-furan-2-ylmethylideneamino]urea |
|---|---|
| PubChem CID | 134113027 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-(2-cyanopropyl)-3-(3,4-dichlorophenyl)-1-[(E)-furan-2-ylmethylideneamino]urea |
| SMILES | CC(C#N)CN(/N=C/c1ccco1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-11(8-19)10-22(20-9-13-3-2-6-24-13)16(23)21-12-4-5-14(17)15(18)7-12/h2-7,9,11H,10H2,1H3,(H,21,23)/b20-9+ |
| InChIKey | YTNDSWVTTMNDLA-AWQFTUOYSA-N |
| XLogP | 4.61 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|