C12H8Cl2N2O2 — CID 4991897
3,4-dichloro-N-(furan-2-ylmethylideneamino)benzamide (PubChem CID 4991897) has the molecular formula C12H8Cl2N2O2 and a molecular weight of 283.11 g/mol. Its IUPAC name is 3,4-dichloro-N-(furan-2-ylmethylideneamino)benzamide.
| Compound Name | 3,4-dichloro-N-(furan-2-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 4991897 |
| Molecular Formula | C12H8Cl2N2O2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 3,4-dichloro-N-(furan-2-ylmethylideneamino)benzamide |
| SMILES | O=C(NN=Cc1ccco1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2O2/c13-10-4-3-8(6-11(10)14)12(17)16-15-7-9-2-1-5-18-9/h1-7H,(H,16,17) |
| InChIKey | KJIWPXLCPXDNML-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|