About cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide)
cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) (PubChem CID 10885414) has the molecular formula C22H18CoN6O4
and a molecular weight of 489.36 g/mol. Its IUPAC name is cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide).
Molecular Properties
| Compound Name | cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) |
| PubChem CID | 10885414 |
| Molecular Formula | C22H18CoN6O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) |
| SMILES | O=C(N/N=C/c1ccco1)c1ccncc1.O=C(N/N=C/c1ccco1)c1ccncc1.[Co] |
| InChI | InChI=1S/2C11H9N3O2.Co/c2*15-11(9-3-5-12-6-4-9)14-13-8-10-2-1-7-16-10;/h2*1-8H,(H,14,15);/b2*13-8+; |
| InChIKey | KYRHJRLNZXHWRT-INMZZCFLSA-N |
| XLogP | 2.87 |
| TPSA | 134.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide)?
The IUPAC name of cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) (CID 10885414) is cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide).
What is the SMILES notation for cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide)?
The canonical SMILES for cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) is O=C(N/N=C/c1ccco1)c1ccncc1.O=C(N/N=C/c1ccco1)c1ccncc1.[Co].
What is the InChIKey of cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide)?
The InChIKey is KYRHJRLNZXHWRT-INMZZCFLSA-N. The full InChI is InChI=1S/2C11H9N3O2.Co/c2*15-11(9-3-5-12-6-4-9)14-13-8-10-2-1-7-16-10;/h2*1-8H,(H,14,15);/b2*13-8+;.
What are the key properties of cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide)?
cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) has a molecular weight of 489.36 g/mol, XLogP of 2.87, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(N-[(E)-furan-2-ylmethylideneamino]pyridine-4-carboxamide) is sourced from PubChem (CID 10885414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).