C9H8N4O2 — CID 768290
N-(furan-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide (PubChem CID 768290) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(furan-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 768290 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-(furan-2-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1ccco1)c1ccn[nH]1 |
| InChI | InChI=1S/C9H8N4O2/c14-9(8-3-4-10-12-8)13-11-6-7-2-1-5-15-7/h1-6H,(H,10,12)(H,13,14) |
| InChIKey | FSXZXXXMFAXQTH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|