C11H9ClN4O — CID 5391786
N-[(Z)-(2-chlorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 5391786) has the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. Its IUPAC name is N-[(Z)-(2-chlorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5391786 |
| Molecular Formula | C11H9ClN4O |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1ccccc1Cl)c1ccn[nH]1 |
| InChI | InChI=1S/C11H9ClN4O/c12-9-4-2-1-3-8(9)7-14-16-11(17)10-5-6-13-15-10/h1-7H,(H,13,15)(H,16,17)/b14-7- |
| InChIKey | PDHWFJRRCSBSPZ-AUWJEWJLSA-N |
| XLogP | 1.83 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|