C19H17Cl2FN4O2S2 — CID 40884139
1-[(4R)-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-(4-chlorophenyl)-1-hydroxyurea (PubChem CID 40884139) has the molecular formula C19H17Cl2FN4O2S2 and a molecular weight of 487.41 g/mol. Its IUPAC name is 1-[(4R)-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-(4-chlorophenyl)-1-hydroxyurea.
| Compound Name | 1-[(4R)-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-(4-chlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 40884139 |
| Molecular Formula | C19H17Cl2FN4O2S2 |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 1-[(4R)-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-3-(4-chlorophenyl)-1-hydroxyurea |
| SMILES | CC1(C)SC(=S)N(/N=C\c2c(F)cccc2Cl)[C@@H]1N(O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2FN4O2S2/c1-19(2)16(26(28)17(27)24-12-8-6-11(20)7-9-12)25(18(29)30-19)23-10-13-14(21)4-3-5-15(13)22/h3-10,16,28H,1-2H3,(H,24,27)/b23-10-/t16-/m1/s1 |
| InChIKey | RNVVIXFSHSZGLG-SQTWMXCFSA-N |
| XLogP | 5.83 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|