C21H23Cl2N5O2S2 — CID 40884127
3-(3,4-dichlorophenyl)-1-[(4S)-3-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 40884127) has the molecular formula C21H23Cl2N5O2S2 and a molecular weight of 512.49 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[(4S)-3-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[(4S)-3-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 40884127 |
| Molecular Formula | C21H23Cl2N5O2S2 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[(4S)-3-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | CN(C)c1ccc(/C=N\N2C(=S)SC(C)(C)[C@@H]2N(O)C(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H23Cl2N5O2S2/c1-21(2)18(28(30)19(29)25-14-7-10-16(22)17(23)11-14)27(20(31)32-21)24-12-13-5-8-15(9-6-13)26(3)4/h5-12,18,30H,1-4H3,(H,25,29)/b24-12-/t18-/m0/s1 |
| InChIKey | KLBVCVMYMUURMQ-SSVUZXLWSA-N |
| XLogP | 5.76 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|