C20H21ClN4O2S2 — CID 40884250
3-(3-chlorophenyl)-1-[(4R)-5,5-dimethyl-3-[(Z)-(4-methylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 40884250) has the molecular formula C20H21ClN4O2S2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(4R)-5,5-dimethyl-3-[(Z)-(4-methylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-(3-chlorophenyl)-1-[(4R)-5,5-dimethyl-3-[(Z)-(4-methylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 40884250 |
| Molecular Formula | C20H21ClN4O2S2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(4R)-5,5-dimethyl-3-[(Z)-(4-methylphenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | Cc1ccc(/C=N\N2C(=S)SC(C)(C)[C@H]2N(O)C(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21ClN4O2S2/c1-13-7-9-14(10-8-13)12-22-24-17(20(2,3)29-19(24)28)25(27)18(26)23-16-6-4-5-15(21)11-16/h4-12,17,27H,1-3H3,(H,23,26)/b22-12-/t17-/m1/s1 |
| InChIKey | DCBHFERBBOPWPG-MTEVNVADSA-N |
| XLogP | 5.34 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|