C17H17N5O4S3 — CID 40831051
1-[(4R)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea (PubChem CID 40831051) has the molecular formula C17H17N5O4S3 and a molecular weight of 451.56 g/mol. Its IUPAC name is 1-[(4R)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(4R)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 40831051 |
| Molecular Formula | C17H17N5O4S3 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 1-[(4R)-5,5-dimethyl-2-sulfanylidene-3-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea |
| SMILES | CC1(C)SC(=S)N(/N=C\c2cccs2)[C@@H]1N(O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N5O4S3/c1-17(2)14(20(16(27)29-17)18-10-13-4-3-9-28-13)21(24)15(23)19-11-5-7-12(8-6-11)22(25)26/h3-10,14,24H,1-2H3,(H,19,23)/b18-10-/t14-/m1/s1 |
| InChIKey | CRJFADGEIIXCTC-FNHQQPGVSA-N |
| XLogP | 4.35 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|