C17H23FN4O2S2 — CID 3728440
3-butyl-1-[3-[(2-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 3728440) has the molecular formula C17H23FN4O2S2 and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-butyl-1-[3-[(2-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-butyl-1-[3-[(2-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 3728440 |
| Molecular Formula | C17H23FN4O2S2 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-butyl-1-[3-[(2-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | CCCCNC(=O)N(O)C1N(N=Cc2ccccc2F)C(=S)SC1(C)C |
| InChI | InChI=1S/C17H23FN4O2S2/c1-4-5-10-19-15(23)22(24)14-17(2,3)26-16(25)21(14)20-11-12-8-6-7-9-13(12)18/h6-9,11,14,24H,4-5,10H2,1-3H3,(H,19,23) |
| InChIKey | LPUCBTOGWHABAG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|