C20H25N3O2S2 — CID 7361041
1-[(4R)-3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea (PubChem CID 7361041) has the molecular formula C20H25N3O2S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(4R)-3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea.
| Compound Name | 1-[(4R)-3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 7361041 |
| Molecular Formula | C20H25N3O2S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 1-[(4R)-3-butyl-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea |
| SMILES | CCCCN1C(=S)SC(C)(C)[C@H]1N(O)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C20H25N3O2S2/c1-4-5-13-22-17(20(2,3)27-19(22)26)23(25)18(24)21-16-12-8-10-14-9-6-7-11-15(14)16/h6-12,17,25H,4-5,13H2,1-3H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | TUFSRHQSEXGCFO-QGZVFWFLSA-N |
| XLogP | 5.30 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|