C31H34N4O3 — CID 40951145
1-[(4R)-5,5-dimethyl-3-naphthalen-1-yl-2-oxo-1-pentylimidazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea (PubChem CID 40951145) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 1-[(4R)-5,5-dimethyl-3-naphthalen-1-yl-2-oxo-1-pentylimidazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea.
| Compound Name | 1-[(4R)-5,5-dimethyl-3-naphthalen-1-yl-2-oxo-1-pentylimidazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 40951145 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 1-[(4R)-5,5-dimethyl-3-naphthalen-1-yl-2-oxo-1-pentylimidazolidin-4-yl]-1-hydroxy-3-naphthalen-1-ylurea |
| SMILES | CCCCCN1C(=O)N(c2cccc3ccccc23)[C@H](N(O)C(=O)Nc2cccc3ccccc23)C1(C)C |
| InChI | InChI=1S/C31H34N4O3/c1-4-5-10-21-33-30(37)34(27-20-12-16-23-14-7-9-18-25(23)27)28(31(33,2)3)35(38)29(36)32-26-19-11-15-22-13-6-8-17-24(22)26/h6-9,11-20,28,38H,4-5,10,21H2,1-3H3,(H,32,36)/t28-/m1/s1 |
| InChIKey | OHRSUBUOSIAJRE-MUUNZHRXSA-N |
| XLogP | 7.45 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|