C19H18ClN5O4S2 — CID 40831024
1-[(4R)-3-[(Z)-(4-chlorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea (PubChem CID 40831024) has the molecular formula C19H18ClN5O4S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 1-[(4R)-3-[(Z)-(4-chlorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(4R)-3-[(Z)-(4-chlorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 40831024 |
| Molecular Formula | C19H18ClN5O4S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 1-[(4R)-3-[(Z)-(4-chlorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxy-3-(4-nitrophenyl)urea |
| SMILES | CC1(C)SC(=S)N(/N=C\c2ccc(Cl)cc2)[C@@H]1N(O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18ClN5O4S2/c1-19(2)16(23(18(30)31-19)21-11-12-3-5-13(20)6-4-12)24(27)17(26)22-14-7-9-15(10-8-14)25(28)29/h3-11,16,27H,1-2H3,(H,22,26)/b21-11-/t16-/m1/s1 |
| InChIKey | LOLPAZYZDLHKLJ-NBZOHKLQSA-N |
| XLogP | 4.94 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|