C17H22ClFN4O2S2 — CID 3845624
3-butyl-1-[3-[(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea (PubChem CID 3845624) has the molecular formula C17H22ClFN4O2S2 and a molecular weight of 432.97 g/mol. Its IUPAC name is 3-butyl-1-[3-[(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea.
| Compound Name | 3-butyl-1-[3-[(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
|---|---|
| PubChem CID | 3845624 |
| Molecular Formula | C17H22ClFN4O2S2 |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-butyl-1-[3-[(2-chloro-6-fluorophenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]-1-hydroxyurea |
| SMILES | CCCCNC(=O)N(O)C1N(N=Cc2c(F)cccc2Cl)C(=S)SC1(C)C |
| InChI | InChI=1S/C17H22ClFN4O2S2/c1-4-5-9-20-15(24)23(25)14-17(2,3)27-16(26)22(14)21-10-11-12(18)7-6-8-13(11)19/h6-8,10,14,25H,4-5,9H2,1-3H3,(H,20,24) |
| InChIKey | ZUTGPWPIPLEPLX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|