C18H19ClN4O2S2 — CID 56687979
1-(3-anilino-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-3-(3-chlorophenyl)-1-hydroxyurea (PubChem CID 56687979) has the molecular formula C18H19ClN4O2S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 1-(3-anilino-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-3-(3-chlorophenyl)-1-hydroxyurea.
| Compound Name | 1-(3-anilino-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-3-(3-chlorophenyl)-1-hydroxyurea |
|---|---|
| PubChem CID | 56687979 |
| Molecular Formula | C18H19ClN4O2S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-(3-anilino-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl)-3-(3-chlorophenyl)-1-hydroxyurea |
| SMILES | CC1(C)SC(=S)N(Nc2ccccc2)C1N(O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN4O2S2/c1-18(2)15(22(17(26)27-18)21-13-8-4-3-5-9-13)23(25)16(24)20-14-10-6-7-12(19)11-14/h3-11,15,21,25H,1-2H3,(H,20,24) |
| InChIKey | TXZPEKMSSQKGPC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|