C20H20Cl2N4O3S2 — CID 3809127
3-(3,4-dichlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea (PubChem CID 3809127) has the molecular formula C20H20Cl2N4O3S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea |
|---|---|
| PubChem CID | 3809127 |
| Molecular Formula | C20H20Cl2N4O3S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-hydroxy-1-[3-[(2-methoxyphenyl)methylideneamino]-5,5-dimethyl-2-sulfanylidene-1,3-thiazolidin-4-yl]urea |
| SMILES | COc1ccccc1C=NN1C(=S)SC(C)(C)C1N(O)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4O3S2/c1-20(2)17(26(28)18(27)24-13-8-9-14(21)15(22)10-13)25(19(30)31-20)23-11-12-6-4-5-7-16(12)29-3/h4-11,17,28H,1-3H3,(H,24,27) |
| InChIKey | KKJQHXPUQNZHQM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|