C21H22N3O3+ — CID 100963881
1-[1-[(2,3-dimethoxyphenyl)methyl]pyridin-1-ium-3-yl]-3-phenylurea (PubChem CID 100963881) has the molecular formula C21H22N3O3+ and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-[1-[(2,3-dimethoxyphenyl)methyl]pyridin-1-ium-3-yl]-3-phenylurea.
| Compound Name | 1-[1-[(2,3-dimethoxyphenyl)methyl]pyridin-1-ium-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 100963881 |
| Molecular Formula | C21H22N3O3+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-[1-[(2,3-dimethoxyphenyl)methyl]pyridin-1-ium-3-yl]-3-phenylurea |
| SMILES | COc1cccc(C[n+]2cccc(NC(=O)Nc3ccccc3)c2)c1OC |
| InChI | InChI=1S/C21H21N3O3/c1-26-19-12-6-8-16(20(19)27-2)14-24-13-7-11-18(15-24)23-21(25)22-17-9-4-3-5-10-17/h3-13,15H,14H2,1-2H3,(H-,22,23,25)/p+1 |
| InChIKey | OMEWQNCFBCYYHN-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|