ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate

C12H15NO4 — CID 12908749

IUPACethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate
SMILESCCOC(=O)c1ccnc(C2COCCO2)c1
InChIInChI=1S/C12H15NO4/c1-2-16-12(14)9-3-4-13-10(7-9)11-8-15-5-6-17-11/h3-4,7,11H,2,5-6,8H2,1H3
InChIKeyJJBJTEHJFMJZSE-UHFFFAOYSA-N
MW237.25 g/mol
LogP1.35
Rot. Bonds3

About ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate

ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate (PubChem CID 12908749) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate.

Molecular Properties

Compound Nameethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate
PubChem CID12908749
Molecular FormulaC12H15NO4
Molecular Weight237.25 g/mol
Exact Mass237.10
IUPAC Nameethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate
SMILESCCOC(=O)c1ccnc(C2COCCO2)c1
InChIInChI=1S/C12H15NO4/c1-2-16-12(14)9-3-4-13-10(7-9)11-8-15-5-6-17-11/h3-4,7,11H,2,5-6,8H2,1H3
InChIKeyJJBJTEHJFMJZSE-UHFFFAOYSA-N
XLogP1.35
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.25
LogP ≤ 51.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate?
The IUPAC name of ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate (CID 12908749) is ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate.
What is the SMILES notation for ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate?
The canonical SMILES for ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate is CCOC(=O)c1ccnc(C2COCCO2)c1.
What is the InChIKey of ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate?
The InChIKey is JJBJTEHJFMJZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-2-16-12(14)9-3-4-13-10(7-9)11-8-15-5-6-17-11/h3-4,7,11H,2,5-6,8H2,1H3.
What are the key properties of ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate?
ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate has a molecular weight of 237.25 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,4-dioxan-2-yl)pyridine-4-carboxylate is sourced from PubChem (CID 12908749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).