C16H16ClNO4 — CID 22557799
ethyl 2-(4-chloro-3,5-dimethoxyphenyl)pyridine-4-carboxylate (PubChem CID 22557799) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is ethyl 2-(4-chloro-3,5-dimethoxyphenyl)pyridine-4-carboxylate.
| Compound Name | ethyl 2-(4-chloro-3,5-dimethoxyphenyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 22557799 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 2-(4-chloro-3,5-dimethoxyphenyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(-c2cc(OC)c(Cl)c(OC)c2)c1 |
| InChI | InChI=1S/C16H16ClNO4/c1-4-22-16(19)10-5-6-18-12(7-10)11-8-13(20-2)15(17)14(9-11)21-3/h5-9H,4H2,1-3H3 |
| InChIKey | GLCZESBGOVFORB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |