C17H20N2O2 — CID 122378001
ethyl 2-(4-tert-butyl-2-pyridinyl)pyridine-4-carboxylate (PubChem CID 122378001) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl 2-(4-tert-butyl-2-pyridinyl)pyridine-4-carboxylate.
| Compound Name | ethyl 2-(4-tert-butyl-2-pyridinyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 122378001 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl 2-(4-tert-butyl-2-pyridinyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(-c2cc(C(C)(C)C)ccn2)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-5-21-16(20)12-6-8-18-14(10-12)15-11-13(7-9-19-15)17(2,3)4/h6-11H,5H2,1-4H3 |
| InChIKey | PYAMNUSXVDNTKD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |