C16H13N3O2 — CID 175253783
ethyl 2-(1,8-naphthyridin-2-yl)pyridine-4-carboxylate (PubChem CID 175253783) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is ethyl 2-(1,8-naphthyridin-2-yl)pyridine-4-carboxylate.
| Compound Name | ethyl 2-(1,8-naphthyridin-2-yl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 175253783 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 2-(1,8-naphthyridin-2-yl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(-c2ccc3cccnc3n2)c1 |
| InChI | InChI=1S/C16H13N3O2/c1-2-21-16(20)12-7-9-17-14(10-12)13-6-5-11-4-3-8-18-15(11)19-13/h3-10H,2H2,1H3 |
| InChIKey | XGDZJLJJZWSTJL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |