C22H13N5O2Ru — CID 175374249
2,6-bis(1,8-naphthyridin-2-yl)pyridine-4-carboxylic acid;ruthenium (PubChem CID 175374249) has the molecular formula C22H13N5O2Ru and a molecular weight of 480.45 g/mol. Its IUPAC name is 2,6-bis(1,8-naphthyridin-2-yl)pyridine-4-carboxylic acid;ruthenium.
| Compound Name | 2,6-bis(1,8-naphthyridin-2-yl)pyridine-4-carboxylic acid;ruthenium |
|---|---|
| PubChem CID | 175374249 |
| Molecular Formula | C22H13N5O2Ru |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 2,6-bis(1,8-naphthyridin-2-yl)pyridine-4-carboxylic acid;ruthenium |
| SMILES | O=C(O)c1cc(-c2ccc3cccnc3n2)nc(-c2ccc3cccnc3n2)c1.[Ru] |
| InChI | InChI=1S/C22H13N5O2.Ru/c28-22(29)15-11-18(16-7-5-13-3-1-9-23-20(13)26-16)25-19(12-15)17-8-6-14-4-2-10-24-21(14)27-17;/h1-12H,(H,28,29); |
| InChIKey | AJMQGXVZTZJKGL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |