C28H21N3O — CID 71449507
4-(1,8-naphthyridin-2-yl)-N-[(4-phenylphenyl)methyl]benzamide (PubChem CID 71449507) has the molecular formula C28H21N3O and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-(1,8-naphthyridin-2-yl)-N-[(4-phenylphenyl)methyl]benzamide.
| Compound Name | 4-(1,8-naphthyridin-2-yl)-N-[(4-phenylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 71449507 |
| Molecular Formula | C28H21N3O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(1,8-naphthyridin-2-yl)-N-[(4-phenylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(-c2ccccc2)cc1)c1ccc(-c2ccc3cccnc3n2)cc1 |
| InChI | InChI=1S/C28H21N3O/c32-28(30-19-20-8-10-22(11-9-20)21-5-2-1-3-6-21)25-14-12-23(13-15-25)26-17-16-24-7-4-18-29-27(24)31-26/h1-18H,19H2,(H,30,32) |
| InChIKey | ANDGFDRZMQRIEG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |