C11H13N3O — CID 117136440
2-(oxolan-2-yl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 117136440) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-(oxolan-2-yl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 2-(oxolan-2-yl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117136440 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-(oxolan-2-yl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | Nc1cccn2cc(C3CCCO3)nc12 |
| InChI | InChI=1S/C11H13N3O/c12-8-3-1-5-14-7-9(13-11(8)14)10-4-2-6-15-10/h1,3,5,7,10H,2,4,6,12H2 |
| InChIKey | OZKRRKBEICHSFX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |