C13H16N2O — CID 117134276
7-methyl-2-(oxan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 117134276) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 7-methyl-2-(oxan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 7-methyl-2-(oxan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117134276 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 7-methyl-2-(oxan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2cc(C3CCCCO3)nc2c1 |
| InChI | InChI=1S/C13H16N2O/c1-10-5-6-15-9-11(14-13(15)8-10)12-4-2-3-7-16-12/h5-6,8-9,12H,2-4,7H2,1H3 |
| InChIKey | AYANSKXYKNQRMK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |