C20H24N2O3S — CID 177183884
1-[2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholin-4-yl]-2-methylidenepentan-1-one (PubChem CID 177183884) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholin-4-yl]-2-methylidenepentan-1-one.
| Compound Name | 1-[2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholin-4-yl]-2-methylidenepentan-1-one |
|---|---|
| PubChem CID | 177183884 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[2-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]morpholin-4-yl]-2-methylidenepentan-1-one |
| SMILES | C=C(CCC)C(=O)N1CCOC(c2nc(-c3ccccc3OC)cs2)C1 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-7-14(2)20(23)22-10-11-25-18(12-22)19-21-16(13-26-19)15-8-5-6-9-17(15)24-3/h5-6,8-9,13,18H,2,4,7,10-12H2,1,3H3 |
| InChIKey | RECXCKPFMGDZGL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|