C13H11BrF2N2OS — CID 177183973
(2R)-2-[4-(2-bromo-4,5-difluorophenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 177183973) has the molecular formula C13H11BrF2N2OS and a molecular weight of 361.21 g/mol. Its IUPAC name is (2R)-2-[4-(2-bromo-4,5-difluorophenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | (2R)-2-[4-(2-bromo-4,5-difluorophenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 177183973 |
| Molecular Formula | C13H11BrF2N2OS |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | (2R)-2-[4-(2-bromo-4,5-difluorophenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Fc1cc(Br)c(-c2csc([C@H]3CNCCO3)n2)cc1F |
| InChI | InChI=1S/C13H11BrF2N2OS/c14-8-4-10(16)9(15)3-7(8)11-6-20-13(18-11)12-5-17-1-2-19-12/h3-4,6,12,17H,1-2,5H2/t12-/m1/s1 |
| InChIKey | XHDSWEBAUFUYOF-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|