C10H10BrF2NO2 — CID 117474310
6-bromo-3,4-difluoro-2-morpholin-2-ylphenol (PubChem CID 117474310) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 6-bromo-3,4-difluoro-2-morpholin-2-ylphenol.
| Compound Name | 6-bromo-3,4-difluoro-2-morpholin-2-ylphenol |
|---|---|
| PubChem CID | 117474310 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 6-bromo-3,4-difluoro-2-morpholin-2-ylphenol |
| SMILES | Oc1c(Br)cc(F)c(F)c1C1CNCCO1 |
| InChI | InChI=1S/C10H10BrF2NO2/c11-5-3-6(12)9(13)8(10(5)15)7-4-14-1-2-16-7/h3,7,14-15H,1-2,4H2 |
| InChIKey | NKGMFLZCLCPFQG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|