C10H15BrN2O3S — CID 146083082
ethyl 2-morpholin-2-yl-1,3-thiazole-4-carboxylate;hydrobromide (PubChem CID 146083082) has the molecular formula C10H15BrN2O3S and a molecular weight of 323.21 g/mol. Its IUPAC name is ethyl 2-morpholin-2-yl-1,3-thiazole-4-carboxylate;hydrobromide.
| Compound Name | ethyl 2-morpholin-2-yl-1,3-thiazole-4-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 146083082 |
| Molecular Formula | C10H15BrN2O3S |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | ethyl 2-morpholin-2-yl-1,3-thiazole-4-carboxylate;hydrobromide |
| SMILES | Br.CCOC(=O)c1csc(C2CNCCO2)n1 |
| InChI | InChI=1S/C10H14N2O3S.BrH/c1-2-14-10(13)7-6-16-9(12-7)8-5-11-3-4-15-8;/h6,8,11H,2-5H2,1H3;1H |
| InChIKey | WWYSFLJKLQQBCJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |