C13H22N2OS — CID 116969136
2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]morpholine (PubChem CID 116969136) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]morpholine.
| Compound Name | 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 116969136 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]morpholine |
| SMILES | CC(C)(C)c1csc(CCC2CNCCO2)n1 |
| InChI | InChI=1S/C13H22N2OS/c1-13(2,3)11-9-17-12(15-11)5-4-10-8-14-6-7-16-10/h9-10,14H,4-8H2,1-3H3 |
| InChIKey | MJDDTUNUZCRIPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |