C14H16N2S — CID 116965302
2-(azetidin-3-yl)-4-(2,5-dimethylphenyl)-1,3-thiazole (PubChem CID 116965302) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-4-(2,5-dimethylphenyl)-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yl)-4-(2,5-dimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116965302 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(azetidin-3-yl)-4-(2,5-dimethylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(C)c(-c2csc(C3CNC3)n2)c1 |
| InChI | InChI=1S/C14H16N2S/c1-9-3-4-10(2)12(5-9)13-8-17-14(16-13)11-6-15-7-11/h3-5,8,11,15H,6-7H2,1-2H3 |
| InChIKey | CKJUJSHIBYFPGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |